C15H27N3O2S — CID 103188514
1-[3-(aminomethyl)phenyl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide (PubChem CID 103188514) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide.
| Compound Name | 1-[3-(aminomethyl)phenyl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 103188514 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylmethanesulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)Cc1cccc(CN)c1 |
| InChI | InChI=1S/C15H27N3O2S/c1-5-18(13(2)11-17(3)4)21(19,20)12-15-8-6-7-14(9-15)10-16/h6-9,13H,5,10-12,16H2,1-4H3 |
| InChIKey | DESGHQJTNSHUKM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |