C9H21N3S — CID 103189022
2-[1-(dimethylamino)propan-2-yl-ethylamino]ethanethioamide (PubChem CID 103189022) has the molecular formula C9H21N3S and a molecular weight of 203.35 g/mol. Its IUPAC name is 2-[1-(dimethylamino)propan-2-yl-ethylamino]ethanethioamide.
| Compound Name | 2-[1-(dimethylamino)propan-2-yl-ethylamino]ethanethioamide |
|---|---|
| PubChem CID | 103189022 |
| Molecular Formula | C9H21N3S |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-[1-(dimethylamino)propan-2-yl-ethylamino]ethanethioamide |
| SMILES | CCN(CC(N)=S)C(C)CN(C)C |
| InChI | InChI=1S/C9H21N3S/c1-5-12(7-9(10)13)8(2)6-11(3)4/h8H,5-7H2,1-4H3,(H2,10,13) |
| InChIKey | VTCKPDCWJDHWMR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|