C14H24ClN3 — CID 103189441
2-N-[(3-amino-5-chlorophenyl)methyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 103189441) has the molecular formula C14H24ClN3 and a molecular weight of 269.82 g/mol. Its IUPAC name is 2-N-[(3-amino-5-chlorophenyl)methyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[(3-amino-5-chlorophenyl)methyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103189441 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-N-[(3-amino-5-chlorophenyl)methyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(Cc1cc(N)cc(Cl)c1)C(C)CN(C)C |
| InChI | InChI=1S/C14H24ClN3/c1-5-18(11(2)9-17(3)4)10-12-6-13(15)8-14(16)7-12/h6-8,11H,5,9-10,16H2,1-4H3 |
| InChIKey | HMYKSPDFKOECKM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|