C19H17N9O2 — CID 10318983
4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 10318983) has the molecular formula C19H17N9O2 and a molecular weight of 403.41 g/mol. Its IUPAC name is 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 10318983 |
| Molecular Formula | C19H17N9O2 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(CCn2ncc3c2nc(N)n2nc(-c4ccco4)nc32)cc1 |
| InChI | InChI=1S/C19H17N9O2/c20-15(26-29)12-5-3-11(4-6-12)7-8-27-17-13(10-22-27)18-23-16(14-2-1-9-30-14)25-28(18)19(21)24-17/h1-6,9-10,29H,7-8H2,(H2,20,26)(H2,21,24) |
| InChIKey | LLSIOEGBVBQMDY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|