C12H21ClN4 — CID 103189857
2-N-[5-(chloromethyl)pyrimidin-2-yl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 103189857) has the molecular formula C12H21ClN4 and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-N-[5-(chloromethyl)pyrimidin-2-yl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[5-(chloromethyl)pyrimidin-2-yl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103189857 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-N-[5-(chloromethyl)pyrimidin-2-yl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(c1ncc(CCl)cn1)C(C)CN(C)C |
| InChI | InChI=1S/C12H21ClN4/c1-5-17(10(2)9-16(3)4)12-14-7-11(6-13)8-15-12/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | JHAFSLNRBZVEPS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|