About 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol
1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol (PubChem CID 103191898) has the molecular formula C13H25N3OS
and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 103191898 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol |
| SMILES | CCN(c1nc(C)c(C(C)O)s1)C(C)CN(C)C |
| InChI | InChI=1S/C13H25N3OS/c1-7-16(9(2)8-15(5)6)13-14-10(3)12(18-13)11(4)17/h9,11,17H,7-8H2,1-6H3 |
| InChIKey | AFJXCOFFZJIQCW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol (CID 103191898) is 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol is CCN(c1nc(C)c(C(C)O)s1)C(C)CN(C)C.
What is the InChIKey of 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol?
The InChIKey is AFJXCOFFZJIQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3OS/c1-7-16(9(2)8-15(5)6)13-14-10(3)12(18-13)11(4)17/h9,11,17H,7-8H2,1-6H3.
What are the key properties of 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol?
1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol has a molecular weight of 271.43 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(dimethylamino)propan-2-yl-ethylamino]-4-methyl-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 103191898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).