C13H22N4O7P2 — CID 10319257
5-(2,6-dioxo-3H-purin-9-yl)pentyl-[[ethoxy(hydroxy)phosphoryl]methyl]phosphinic acid (PubChem CID 10319257) has the molecular formula C13H22N4O7P2 and a molecular weight of 408.29 g/mol. Its IUPAC name is 5-(2,6-dioxo-3H-purin-9-yl)pentyl-[[ethoxy(hydroxy)phosphoryl]methyl]phosphinic acid.
| Compound Name | 5-(2,6-dioxo-3H-purin-9-yl)pentyl-[[ethoxy(hydroxy)phosphoryl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 10319257 |
| Molecular Formula | C13H22N4O7P2 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 5-(2,6-dioxo-3H-purin-9-yl)pentyl-[[ethoxy(hydroxy)phosphoryl]methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CP(=O)(O)CCCCCn1cnc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C13H22N4O7P2/c1-2-24-26(22,23)9-25(20,21)7-5-3-4-6-17-8-14-10-11(17)15-13(19)16-12(10)18/h8H,2-7,9H2,1H3,(H,20,21)(H,22,23)(H2,15,16,18,19) |
| InChIKey | HZVOKFNRZQABAY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 167.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|