C12H13BrF3NO2 — CID 103192873
4-bromo-N-(oxolan-3-ylmethyl)-2-(trifluoromethoxy)aniline (PubChem CID 103192873) has the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. Its IUPAC name is 4-bromo-N-(oxolan-3-ylmethyl)-2-(trifluoromethoxy)aniline.
| Compound Name | 4-bromo-N-(oxolan-3-ylmethyl)-2-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 103192873 |
| Molecular Formula | C12H13BrF3NO2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-bromo-N-(oxolan-3-ylmethyl)-2-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1cc(Br)ccc1NCC1CCOC1 |
| InChI | InChI=1S/C12H13BrF3NO2/c13-9-1-2-10(11(5-9)19-12(14,15)16)17-6-8-3-4-18-7-8/h1-2,5,8,17H,3-4,6-7H2 |
| InChIKey | KYCIJTXEBRULPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |