C26H24N4O — CID 10319288
2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile (PubChem CID 10319288) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile.
| Compound Name | 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
|---|---|
| PubChem CID | 10319288 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
| SMILES | N#CC(c1cccnc1)N1CCN(C(=O)C=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24N4O/c27-19-25(23-12-7-13-28-20-23)29-14-16-30(17-15-29)26(31)18-24(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-13,18,20,25H,14-17H2 |
| InChIKey | RNAXOONKFLLUCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|