C13H11BrF3NO — CID 103193574
1-[4-bromo-2-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole (PubChem CID 103193574) has the molecular formula C13H11BrF3NO and a molecular weight of 334.14 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole.
| Compound Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 103193574 |
| Molecular Formula | C13H11BrF3NO |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H11BrF3NO/c1-8-3-4-9(2)18(8)11-6-5-10(14)7-12(11)19-13(15,16)17/h3-7H,1-2H3 |
| InChIKey | CUDLILBYDPEZGT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|