C13H17FIN3O — CID 103194407
1-(2-amino-5-fluoro-4-iodophenyl)-N-methylpiperidine-3-carboxamide (PubChem CID 103194407) has the molecular formula C13H17FIN3O and a molecular weight of 377.20 g/mol. Its IUPAC name is 1-(2-amino-5-fluoro-4-iodophenyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(2-amino-5-fluoro-4-iodophenyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103194407 |
| Molecular Formula | C13H17FIN3O |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 1-(2-amino-5-fluoro-4-iodophenyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(c2cc(F)c(I)cc2N)C1 |
| InChI | InChI=1S/C13H17FIN3O/c1-17-13(19)8-3-2-4-18(7-8)12-5-9(14)10(15)6-11(12)16/h5-6,8H,2-4,7,16H2,1H3,(H,17,19) |
| InChIKey | JUXIDDVBEWIUHG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|