C16H23N3O2 — CID 103194492
1-(3-amino-5-propan-2-yloxyphenyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194492) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(3-amino-5-propan-2-yloxyphenyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(3-amino-5-propan-2-yloxyphenyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194492 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(3-amino-5-propan-2-yloxyphenyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(C)Oc1cc(N)cc(N2CCCC3C(=O)NCC32)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-10(2)21-13-7-11(17)6-12(8-13)19-5-3-4-14-15(19)9-18-16(14)20/h6-8,10,14-15H,3-5,9,17H2,1-2H3,(H,18,20) |
| InChIKey | NBCJJCXYNGBBQG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|