C19H30BrNO2Si — CID 10319470
(5S,6S)-1-benzyl-6-(bromomethyl)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one (PubChem CID 10319470) has the molecular formula C19H30BrNO2Si and a molecular weight of 412.44 g/mol. Its IUPAC name is (5S,6S)-1-benzyl-6-(bromomethyl)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one.
| Compound Name | (5S,6S)-1-benzyl-6-(bromomethyl)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
|---|---|
| PubChem CID | 10319470 |
| Molecular Formula | C19H30BrNO2Si |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (5S,6S)-1-benzyl-6-(bromomethyl)-5-[tert-butyl(dimethyl)silyl]oxypiperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)N(Cc2ccccc2)[C@@H]1CBr |
| InChI | InChI=1S/C19H30BrNO2Si/c1-19(2,3)24(4,5)23-17-11-12-18(22)21(16(17)13-20)14-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3/t16-,17+/m1/s1 |
| InChIKey | CRZAYFOHLKZLOT-SJORKVTESA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|