C13H25N3O2 — CID 103194932
1-(4-amino-3-ethoxybutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103194932) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-(4-amino-3-ethoxybutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(4-amino-3-ethoxybutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103194932 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1-(4-amino-3-ethoxybutyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CCOC(CN)CCN1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C13H25N3O2/c1-2-18-10(8-14)5-7-16-6-3-4-11-12(16)9-15-13(11)17/h10-12H,2-9,14H2,1H3,(H,15,17) |
| InChIKey | HRBVITFFEPNTGN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |