C27H28N2O2 — CID 10319494
4-(8,8,11,11-tetramethyl-5,6,9,10-tetrahydronaphtho[2,3-h]cinnolin-4-yl)benzoic acid (PubChem CID 10319494) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-(8,8,11,11-tetramethyl-5,6,9,10-tetrahydronaphtho[2,3-h]cinnolin-4-yl)benzoic acid.
| Compound Name | 4-(8,8,11,11-tetramethyl-5,6,9,10-tetrahydronaphtho[2,3-h]cinnolin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 10319494 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-(8,8,11,11-tetramethyl-5,6,9,10-tetrahydronaphtho[2,3-h]cinnolin-4-yl)benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)cnnc1-3 |
| InChI | InChI=1S/C27H28N2O2/c1-26(2)11-12-27(3,4)23-14-20-18(13-22(23)26)9-10-19-21(15-28-29-24(19)20)16-5-7-17(8-6-16)25(30)31/h5-8,13-15H,9-12H2,1-4H3,(H,30,31) |
| InChIKey | IYOYVLBTKKRLBC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |