C20H25F2NO4S — CID 10319556
4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-(7-hydroxy-6-oxoheptyl)-1,3-thiazolidin-2-one (PubChem CID 10319556) has the molecular formula C20H25F2NO4S and a molecular weight of 413.49 g/mol. Its IUPAC name is 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-(7-hydroxy-6-oxoheptyl)-1,3-thiazolidin-2-one.
| Compound Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-(7-hydroxy-6-oxoheptyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 10319556 |
| Molecular Formula | C20H25F2NO4S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-(7-hydroxy-6-oxoheptyl)-1,3-thiazolidin-2-one |
| SMILES | O=C(CO)CCCCCN1C(=O)SCC1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C20H25F2NO4S/c21-20(22,15-7-3-1-4-8-15)18(26)11-10-16-14-28-19(27)23(16)12-6-2-5-9-17(25)13-24/h1,3-4,7-8,10-11,16,18,24,26H,2,5-6,9,12-14H2/b11-10+ |
| InChIKey | CYYNOHIYQRXNPG-ZHACJKMWSA-N |
| XLogP | 3.35 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|