C15H18N4O — CID 103195610
4,6-dimethyl-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)pyridine-3-carbonitrile (PubChem CID 103195610) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4,6-dimethyl-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103195610 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4,6-dimethyl-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(N2CCCC3C(=O)NCC32)n1 |
| InChI | InChI=1S/C15H18N4O/c1-9-6-10(2)18-14(12(9)7-16)19-5-3-4-11-13(19)8-17-15(11)20/h6,11,13H,3-5,8H2,1-2H3,(H,17,20) |
| InChIKey | DFBPAFDIOVEKIN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |