C15H27N3O2 — CID 103195689
6-[(4-propan-2-ylmorpholin-2-yl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103195689) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 6-[(4-propan-2-ylmorpholin-2-yl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[(4-propan-2-ylmorpholin-2-yl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103195689 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 6-[(4-propan-2-ylmorpholin-2-yl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(C)N1CCOC(CN2CC3NCCCC3C2=O)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-11(2)17-6-7-20-12(8-17)9-18-10-14-13(15(18)19)4-3-5-16-14/h11-14,16H,3-10H2,1-2H3 |
| InChIKey | MAMOMFJKGGHWJM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |