C12H22N2O2 — CID 103195752
6-(4-methoxybutyl)-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103195752) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 6-(4-methoxybutyl)-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-(4-methoxybutyl)-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103195752 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 6-(4-methoxybutyl)-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COCCCCN1CC2NCCCC2C1=O |
| InChI | InChI=1S/C12H22N2O2/c1-16-8-3-2-7-14-9-11-10(12(14)15)5-4-6-13-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | DXUMCVRDYBHKTL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|