About S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate
S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate (PubChem CID 10319576) has the molecular formula C25H35NO2S
and a molecular weight of 413.63 g/mol. Its IUPAC name is S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate.
Molecular Properties
| Compound Name | S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate |
| PubChem CID | 10319576 |
| Molecular Formula | C25H35NO2S |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate |
| SMILES | CC(C)[C@@H]([C@@H](O)CC(=O)SC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2S/c1-19(2)24(22(27)16-23(28)29-25(3,4)5)26(17-20-12-8-6-9-13-20)18-21-14-10-7-11-15-21/h6-15,19,22,24,27H,16-18H2,1-5H3/t22-,24-/m0/s1 |
| InChIKey | OSQMCAHOYFIXOL-UPVQGACJSA-N |
| XLogP | 5.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate?
The IUPAC name of S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate (CID 10319576) is S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate.
What is the SMILES notation for S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate?
The canonical SMILES for S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate is CC(C)[C@@H]([C@@H](O)CC(=O)SC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate?
The InChIKey is OSQMCAHOYFIXOL-UPVQGACJSA-N. The full InChI is InChI=1S/C25H35NO2S/c1-19(2)24(22(27)16-23(28)29-25(3,4)5)26(17-20-12-8-6-9-13-20)18-21-14-10-7-11-15-21/h6-15,19,22,24,27H,16-18H2,1-5H3/t22-,24-/m0/s1.
What are the key properties of S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate?
S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate has a molecular weight of 413.63 g/mol, XLogP of 5.52, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-methylhexanethioate is sourced from PubChem (CID 10319576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).