C14H15ClN2O3 — CID 103196554
4-chloro-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzoic acid (PubChem CID 103196554) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-chloro-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzoic acid.
| Compound Name | 4-chloro-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 103196554 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-chloro-2-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)cc1N1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C14H15ClN2O3/c15-8-3-4-10(14(19)20)11(6-8)17-5-1-2-9-12(17)7-16-13(9)18/h3-4,6,9,12H,1-2,5,7H2,(H,16,18)(H,19,20) |
| InChIKey | CGMWGKGLFFYFOR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |