C13H18ClN3OS — CID 103197411
1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103197411) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103197411 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(c1nc(CCl)cs1)N1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C13H18ClN3OS/c1-8(13-16-9(5-14)7-19-13)17-4-2-3-10-11(17)6-15-12(10)18/h7-8,10-11H,2-6H2,1H3,(H,15,18) |
| InChIKey | YCEWVKPEIVLCDO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|