C16H20N4O — CID 103198031
2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-2-phenylpropanenitrile (PubChem CID 103198031) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-2-phenylpropanenitrile.
| Compound Name | 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 103198031 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-2-phenylpropanenitrile |
| SMILES | N#CC(N)(CN1CCCC2C(=O)NCC21)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O/c17-10-16(18,12-5-2-1-3-6-12)11-20-8-4-7-13-14(20)9-19-15(13)21/h1-3,5-6,13-14H,4,7-9,11,18H2,(H,19,21) |
| InChIKey | ZCXGSQVSPYFGTD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |