C14H20N2O2S — CID 103198218
1-(2-methylsulfonylphenyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 103198218) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(2-methylsulfonylphenyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-(2-methylsulfonylphenyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 103198218 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(2-methylsulfonylphenyl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CS(=O)(=O)c1ccccc1N1CCCC2CNCC21 |
| InChI | InChI=1S/C14H20N2O2S/c1-19(17,18)14-7-3-2-6-12(14)16-8-4-5-11-9-15-10-13(11)16/h2-3,6-7,11,13,15H,4-5,8-10H2,1H3 |
| InChIKey | YYOAEFGBCIMCQJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |