C27H31NO3 — CID 10319829
8-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethyloctanoic acid (PubChem CID 10319829) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 8-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethyloctanoic acid.
| Compound Name | 8-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 10319829 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 8-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethyloctanoic acid |
| SMILES | CC(C)(CCCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C27H31NO3/c1-27(2,26(29)30)17-11-3-4-12-18-31-25-20-23(21-13-7-5-8-14-21)19-24(28-25)22-15-9-6-10-16-22/h5-10,13-16,19-20H,3-4,11-12,17-18H2,1-2H3,(H,29,30) |
| InChIKey | WFPFILGYCCUVGQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|