C24H35NO3S — CID 10319835
7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid (PubChem CID 10319835) has the molecular formula C24H35NO3S and a molecular weight of 417.62 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 10319835 |
| Molecular Formula | C24H35NO3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-(3-propylphenyl)but-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
| SMILES | CCCc1cccc(C[C@H](O)/C=C/[C@H]2CCC(=S)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C24H35NO3S/c1-2-8-19-9-7-10-20(17-19)18-22(26)14-12-21-13-15-23(29)25(21)16-6-4-3-5-11-24(27)28/h7,9-10,12,14,17,21-22,26H,2-6,8,11,13,15-16,18H2,1H3,(H,27,28)/b14-12+/t21-,22+/m0/s1 |
| InChIKey | MVMGLBVDIRQELW-HNSSNFPDSA-N |
| XLogP | 4.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|