C24H38N2O4 — CID 10319880
tert-butyl 2-[(1S)-6-methoxy-2-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]iminomethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetate (PubChem CID 10319880) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-6-methoxy-2-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]iminomethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1S)-6-methoxy-2-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]iminomethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 10319880 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | tert-butyl 2-[(1S)-6-methoxy-2-[[(2S)-1-methoxy-3,3-dimethylbutan-2-yl]iminomethyl]-3,4-dihydro-1H-isoquinolin-1-yl]acetate |
| SMILES | COC[C@@H](/N=C/N1CCc2cc(OC)ccc2[C@@H]1CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H38N2O4/c1-23(2,3)21(15-28-7)25-16-26-12-11-17-13-18(29-8)9-10-19(17)20(26)14-22(27)30-24(4,5)6/h9-10,13,16,20-21H,11-12,14-15H2,1-8H3/b25-16+/t20-,21+/m0/s1 |
| InChIKey | YQFCKYWVLHKIDV-JLCFHOEASA-N |
| XLogP | 4.42 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|