C24H32O6 — CID 10319969
[2-[(2S,10S,11S,13R,14R,15S)-14-hydroxy-2,13,15-trimethyl-5-oxo-3,4-ditritio-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] acetate (PubChem CID 10319969) has the molecular formula C24H32O6 and a molecular weight of 420.53 g/mol. Its IUPAC name is [2-[(2S,10S,11S,13R,14R,15S)-14-hydroxy-2,13,15-trimethyl-5-oxo-3,4-ditritio-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(2S,10S,11S,13R,14R,15S)-14-hydroxy-2,13,15-trimethyl-5-oxo-3,4-ditritio-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10319969 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [2-[(2S,10S,11S,13R,14R,15S)-14-hydroxy-2,13,15-trimethyl-5-oxo-3,4-ditritio-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] acetate |
| SMILES | [3H]C1C(=O)C=C2CC[C@H]3[C@@H]4C[C@@H](C)[C@](O)(C(=O)COC(C)=O)[C@@]4(C)CC4OC43[C@@]2(C)C1[3H] |
| InChI | InChI=1S/C24H32O6/c1-13-9-18-17-6-5-15-10-16(26)7-8-21(15,3)24(17)20(30-24)11-22(18,4)23(13,28)19(27)12-29-14(2)25/h10,13,17-18,20,28H,5-9,11-12H2,1-4H3/t13-,17+,18+,20?,21+,22+,23+,24?/m1/s1/i7T,8T/t7?,8?,13-,17+,18+,20?,21+,22+,23+,24? |
| InChIKey | FOTDGVYUEIORAP-DDLDGHODSA-N |
| XLogP | 2.76 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|