C26H35N3O2 — CID 10320022
N,N-diethyl-4-(3-hydroxy-N-[(3S,4R)-3-methyl-1-prop-2-enylpiperidin-4-yl]anilino)benzamide (PubChem CID 10320022) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N,N-diethyl-4-(3-hydroxy-N-[(3S,4R)-3-methyl-1-prop-2-enylpiperidin-4-yl]anilino)benzamide.
| Compound Name | N,N-diethyl-4-(3-hydroxy-N-[(3S,4R)-3-methyl-1-prop-2-enylpiperidin-4-yl]anilino)benzamide |
|---|---|
| PubChem CID | 10320022 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N,N-diethyl-4-(3-hydroxy-N-[(3S,4R)-3-methyl-1-prop-2-enylpiperidin-4-yl]anilino)benzamide |
| SMILES | C=CCN1CC[C@@H](N(c2ccc(C(=O)N(CC)CC)cc2)c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C26H35N3O2/c1-5-16-27-17-15-25(20(4)19-27)29(23-9-8-10-24(30)18-23)22-13-11-21(12-14-22)26(31)28(6-2)7-3/h5,8-14,18,20,25,30H,1,6-7,15-17,19H2,2-4H3/t20-,25+/m0/s1 |
| InChIKey | VRFHDRZAAWMJKZ-NBGIEHNGSA-N |
| XLogP | 4.91 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|