C8H5ClF2N4O2 — CID 103200454
methyl 7-[chloro(difluoro)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 103200454) has the molecular formula C8H5ClF2N4O2 and a molecular weight of 262.60 g/mol. Its IUPAC name is methyl 7-[chloro(difluoro)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 7-[chloro(difluoro)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 103200454 |
| Molecular Formula | C8H5ClF2N4O2 |
| Molecular Weight | 262.60 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | methyl 7-[chloro(difluoro)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2nccc(C(F)(F)Cl)n2n1 |
| InChI | InChI=1S/C8H5ClF2N4O2/c1-17-6(16)5-13-7-12-3-2-4(8(9,10)11)15(7)14-5/h2-3H,1H3 |
| InChIKey | KXULQWKVIMNPRX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.60 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|