C10H8N4O3 — CID 103200466
methyl 5-oxo-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-11-carboxylate (PubChem CID 103200466) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is methyl 5-oxo-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-11-carboxylate.
| Compound Name | methyl 5-oxo-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 103200466 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | methyl 5-oxo-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-11-carboxylate |
| SMILES | COC(=O)c1nc2ncc3c(n2n1)CCC3=O |
| InChI | InChI=1S/C10H8N4O3/c1-17-9(16)8-12-10-11-4-5-6(14(10)13-8)2-3-7(5)15/h4H,2-3H2,1H3 |
| InChIKey | QJORZYKHVRUSFM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |