About ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate
ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 10320152) has the molecular formula C27H24N2O3
and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 10320152 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1ncc2[nH]c3ccc(OCc4cccc5ccccc45)cc3c2c1CC |
| InChI | InChI=1S/C27H24N2O3/c1-3-20-25-22-14-19(32-16-18-10-7-9-17-8-5-6-11-21(17)18)12-13-23(22)29-24(25)15-28-26(20)27(30)31-4-2/h5-15,29H,3-4,16H2,1-2H3 |
| InChIKey | OFGIZFXJRFHYNA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate (CID 10320152) is ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate is CCOC(=O)c1ncc2[nH]c3ccc(OCc4cccc5ccccc45)cc3c2c1CC.
What is the InChIKey of ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is OFGIZFXJRFHYNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O3/c1-3-20-25-22-14-19(32-16-18-10-7-9-17-8-5-6-11-21(17)18)12-13-23(22)29-24(25)15-28-26(20)27(30)31-4-2/h5-15,29H,3-4,16H2,1-2H3.
What are the key properties of ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate?
ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 424.50 g/mol, XLogP of 6.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethyl-6-(naphthalen-1-ylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 10320152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).