About tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate
tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate (PubChem CID 10320219) has the molecular formula C24H43NO5
and a molecular weight of 425.61 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate |
| PubChem CID | 10320219 |
| Molecular Formula | C24H43NO5 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate |
| SMILES | CC(C)C(=O)C[C@H](OC1CCCCO1)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43NO5/c1-17(2)20(26)16-21(29-22-13-9-10-14-28-22)19(15-18-11-7-6-8-12-18)25-23(27)30-24(3,4)5/h17-19,21-22H,6-16H2,1-5H3,(H,25,27)/t19-,21-,22?/m0/s1 |
| InChIKey | VEZQQNBWOCIDNX-QUCQDJGISA-N |
| XLogP | 5.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate (CID 10320219) is tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate is CC(C)C(=O)C[C@H](OC1CCCCO1)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate?
The InChIKey is VEZQQNBWOCIDNX-QUCQDJGISA-N. The full InChI is InChI=1S/C24H43NO5/c1-17(2)20(26)16-21(29-22-13-9-10-14-28-22)19(15-18-11-7-6-8-12-18)25-23(27)30-24(3,4)5/h17-19,21-22H,6-16H2,1-5H3,(H,25,27)/t19-,21-,22?/m0/s1.
What are the key properties of tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate?
tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate has a molecular weight of 425.61 g/mol, XLogP of 5.38, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S,3S)-1-cyclohexyl-6-methyl-3-(oxan-2-yloxy)-5-oxoheptan-2-yl]carbamate is sourced from PubChem (CID 10320219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).