C20H21N5O6 — CID 10320311
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methoxyamino)-2-[2-(4-methoxyphenyl)ethynyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 10320311) has the molecular formula C20H21N5O6 and a molecular weight of 427.42 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methoxyamino)-2-[2-(4-methoxyphenyl)ethynyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methoxyamino)-2-[2-(4-methoxyphenyl)ethynyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10320311 |
| Molecular Formula | C20H21N5O6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methoxyamino)-2-[2-(4-methoxyphenyl)ethynyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | CONc1nc(C#Cc2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21N5O6/c1-29-12-6-3-11(4-7-12)5-8-14-22-18(24-30-2)15-19(23-14)25(10-21-15)20-17(28)16(27)13(9-26)31-20/h3-4,6-7,10,13,16-17,20,26-28H,9H2,1-2H3,(H,22,23,24)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | MZYNTNQYNANXII-AEVYOOLXSA-N |
| XLogP | -0.18 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|