C14H15N3O — CID 103203332
4-[(4-hydroxy-2-methylanilino)methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 103203332) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(4-hydroxy-2-methylanilino)methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[(4-hydroxy-2-methylanilino)methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 103203332 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(4-hydroxy-2-methylanilino)methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | Cc1cc(O)ccc1NCc1cc(C#N)n(C)c1 |
| InChI | InChI=1S/C14H15N3O/c1-10-5-13(18)3-4-14(10)16-8-11-6-12(7-15)17(2)9-11/h3-6,9,16,18H,8H2,1-2H3 |
| InChIKey | IHIUOKHFRYXYOW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|