About N-hexan-3-yl-1,2,4-benzotriazin-3-amine
N-hexan-3-yl-1,2,4-benzotriazin-3-amine (PubChem CID 103204245) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-hexan-3-yl-1,2,4-benzotriazin-3-amine.
Molecular Properties
| Compound Name | N-hexan-3-yl-1,2,4-benzotriazin-3-amine |
| PubChem CID | 103204245 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-hexan-3-yl-1,2,4-benzotriazin-3-amine |
| SMILES | CCCC(CC)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H18N4/c1-3-7-10(4-2)14-13-15-11-8-5-6-9-12(11)16-17-13/h5-6,8-10H,3-4,7H2,1-2H3,(H,14,15,17) |
| InChIKey | HKSCJJKSLNMSMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-hexan-3-yl-1,2,4-benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-3-yl-1,2,4-benzotriazin-3-amine?
The IUPAC name of N-hexan-3-yl-1,2,4-benzotriazin-3-amine (CID 103204245) is N-hexan-3-yl-1,2,4-benzotriazin-3-amine.
What is the SMILES notation for N-hexan-3-yl-1,2,4-benzotriazin-3-amine?
The canonical SMILES for N-hexan-3-yl-1,2,4-benzotriazin-3-amine is CCCC(CC)Nc1nnc2ccccc2n1.
What is the InChIKey of N-hexan-3-yl-1,2,4-benzotriazin-3-amine?
The InChIKey is HKSCJJKSLNMSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-3-7-10(4-2)14-13-15-11-8-5-6-9-12(11)16-17-13/h5-6,8-10H,3-4,7H2,1-2H3,(H,14,15,17).
What are the key properties of N-hexan-3-yl-1,2,4-benzotriazin-3-amine?
N-hexan-3-yl-1,2,4-benzotriazin-3-amine has a molecular weight of 230.31 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-3-yl-1,2,4-benzotriazin-3-amine is sourced from PubChem (CID 103204245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).