C13H18N4 — CID 103204245
N-hexan-3-yl-1,2,4-benzotriazin-3-amine (PubChem CID 103204245) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-hexan-3-yl-1,2,4-benzotriazin-3-amine.
| Compound Name | N-hexan-3-yl-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204245 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-hexan-3-yl-1,2,4-benzotriazin-3-amine |
| SMILES | CCCC(CC)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H18N4/c1-3-7-10(4-2)14-13-15-11-8-5-6-9-12(11)16-17-13/h5-6,8-10H,3-4,7H2,1-2H3,(H,14,15,17) |
| InChIKey | HKSCJJKSLNMSMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |