C14H15F4N3O4S2 — CID 10320427
2-(4-azido-2,3,5,6-tetrafluorophenyl)-5-tert-butyl-1,3-dithiane 1,1,3,3-tetraoxide (PubChem CID 10320427) has the molecular formula C14H15F4N3O4S2 and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-(4-azido-2,3,5,6-tetrafluorophenyl)-5-tert-butyl-1,3-dithiane 1,1,3,3-tetraoxide.
| Compound Name | 2-(4-azido-2,3,5,6-tetrafluorophenyl)-5-tert-butyl-1,3-dithiane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 10320427 |
| Molecular Formula | C14H15F4N3O4S2 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-(4-azido-2,3,5,6-tetrafluorophenyl)-5-tert-butyl-1,3-dithiane 1,1,3,3-tetraoxide |
| SMILES | CC(C)(C)C1CS(=O)(=O)C(c2c(F)c(F)c(N=[N+]=[N-])c(F)c2F)S(=O)(=O)C1 |
| InChI | InChI=1S/C14H15F4N3O4S2/c1-14(2,3)6-4-26(22,23)13(27(24,25)5-6)7-8(15)10(17)12(20-21-19)11(18)9(7)16/h6,13H,4-5H2,1-3H3 |
| InChIKey | WDOUDTBHUVGDCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 117.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|