C27H27NO4 — CID 10320441
2-[[6-[(2E)-2-benzhydryloxyiminoethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 10320441) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[[6-[(2E)-2-benzhydryloxyiminoethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[(2E)-2-benzhydryloxyiminoethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 10320441 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[[6-[(2E)-2-benzhydryloxyiminoethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC(C/C=N/OC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C27H27NO4/c29-26(30)19-31-25-13-7-12-23-18-20(14-15-24(23)25)16-17-28-32-27(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-13,17,20,27H,14-16,18-19H2,(H,29,30)/b28-17+ |
| InChIKey | KHZVLIGYCOKVNA-OGLMXYFKSA-N |
| XLogP | 5.44 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|