About N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine
N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204496) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine.
Molecular Properties
| Compound Name | N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine |
| PubChem CID | 103204496 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine |
| SMILES | CCOC(C)CNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H16N4O/c1-3-17-9(2)8-13-12-14-10-6-4-5-7-11(10)15-16-12/h4-7,9H,3,8H2,1-2H3,(H,13,14,16) |
| InChIKey | QNFLTIYZTSAYIK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine?
The IUPAC name of N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine (CID 103204496) is N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine.
What is the SMILES notation for N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine?
The canonical SMILES for N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine is CCOC(C)CNc1nnc2ccccc2n1.
What is the InChIKey of N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine?
The InChIKey is QNFLTIYZTSAYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-3-17-9(2)8-13-12-14-10-6-4-5-7-11(10)15-16-12/h4-7,9H,3,8H2,1-2H3,(H,13,14,16).
What are the key properties of N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine?
N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine has a molecular weight of 232.29 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxypropyl)-1,2,4-benzotriazin-3-amine is sourced from PubChem (CID 103204496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).