About N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine
N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204553) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine.
Molecular Properties
| Compound Name | N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine |
| PubChem CID | 103204553 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine |
| SMILES | COC(C)CNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H14N4O/c1-8(16-2)7-12-11-13-9-5-3-4-6-10(9)14-15-11/h3-6,8H,7H2,1-2H3,(H,12,13,15) |
| InChIKey | HUXJPMVDSFXHTB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine?
The IUPAC name of N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine (CID 103204553) is N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine.
What is the SMILES notation for N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine?
The canonical SMILES for N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine is COC(C)CNc1nnc2ccccc2n1.
What is the InChIKey of N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine?
The InChIKey is HUXJPMVDSFXHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-8(16-2)7-12-11-13-9-5-3-4-6-10(9)14-15-11/h3-6,8H,7H2,1-2H3,(H,12,13,15).
What are the key properties of N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine?
N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine has a molecular weight of 218.26 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxypropyl)-1,2,4-benzotriazin-3-amine is sourced from PubChem (CID 103204553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).