C15H12N4O2 — CID 103204594
1-[5-amino-2-(1,2,4-benzotriazin-3-yloxy)phenyl]ethanone (PubChem CID 103204594) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-[5-amino-2-(1,2,4-benzotriazin-3-yloxy)phenyl]ethanone.
| Compound Name | 1-[5-amino-2-(1,2,4-benzotriazin-3-yloxy)phenyl]ethanone |
|---|---|
| PubChem CID | 103204594 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[5-amino-2-(1,2,4-benzotriazin-3-yloxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(N)ccc1Oc1nnc2ccccc2n1 |
| InChI | InChI=1S/C15H12N4O2/c1-9(20)11-8-10(16)6-7-14(11)21-15-17-12-4-2-3-5-13(12)18-19-15/h2-8H,16H2,1H3 |
| InChIKey | QHORYEPUKJHQAC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|