About 3-(azetidin-3-yloxy)-1,2,4-benzotriazine
3-(azetidin-3-yloxy)-1,2,4-benzotriazine (PubChem CID 103204985) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 3-(azetidin-3-yloxy)-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 3-(azetidin-3-yloxy)-1,2,4-benzotriazine |
| PubChem CID | 103204985 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-(azetidin-3-yloxy)-1,2,4-benzotriazine |
| SMILES | c1ccc2nc(OC3CNC3)nnc2c1 |
| InChI | InChI=1S/C10H10N4O/c1-2-4-9-8(3-1)12-10(14-13-9)15-7-5-11-6-7/h1-4,7,11H,5-6H2 |
| InChIKey | QDHQBVQTWVEVKH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(azetidin-3-yloxy)-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azetidin-3-yloxy)-1,2,4-benzotriazine?
The IUPAC name of 3-(azetidin-3-yloxy)-1,2,4-benzotriazine (CID 103204985) is 3-(azetidin-3-yloxy)-1,2,4-benzotriazine.
What is the SMILES notation for 3-(azetidin-3-yloxy)-1,2,4-benzotriazine?
The canonical SMILES for 3-(azetidin-3-yloxy)-1,2,4-benzotriazine is c1ccc2nc(OC3CNC3)nnc2c1.
What is the InChIKey of 3-(azetidin-3-yloxy)-1,2,4-benzotriazine?
The InChIKey is QDHQBVQTWVEVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c1-2-4-9-8(3-1)12-10(14-13-9)15-7-5-11-6-7/h1-4,7,11H,5-6H2.
What are the key properties of 3-(azetidin-3-yloxy)-1,2,4-benzotriazine?
3-(azetidin-3-yloxy)-1,2,4-benzotriazine has a molecular weight of 202.22 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azetidin-3-yloxy)-1,2,4-benzotriazine is sourced from PubChem (CID 103204985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).