C14H19N5 — CID 103205238
[1-(1,2,4-benzotriazin-3-yl)azepan-2-yl]methanamine (PubChem CID 103205238) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is [1-(1,2,4-benzotriazin-3-yl)azepan-2-yl]methanamine.
| Compound Name | [1-(1,2,4-benzotriazin-3-yl)azepan-2-yl]methanamine |
|---|---|
| PubChem CID | 103205238 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [1-(1,2,4-benzotriazin-3-yl)azepan-2-yl]methanamine |
| SMILES | NCC1CCCCCN1c1nnc2ccccc2n1 |
| InChI | InChI=1S/C14H19N5/c15-10-11-6-2-1-5-9-19(11)14-16-12-7-3-4-8-13(12)17-18-14/h3-4,7-8,11H,1-2,5-6,9-10,15H2 |
| InChIKey | KZCOAHMDNMXDHF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |