C12H15F3N2O3 — CID 103205581
N-[(5-amino-2-hydroxyphenyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103205581) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is N-[(5-amino-2-hydroxyphenyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[(5-amino-2-hydroxyphenyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103205581 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[(5-amino-2-hydroxyphenyl)methyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | Nc1ccc(O)c(CNC(=O)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O3/c13-12(14,15)7-20-4-3-11(19)17-6-8-5-9(16)1-2-10(8)18/h1-2,5,18H,3-4,6-7,16H2,(H,17,19) |
| InChIKey | LQFHSGSPQLEMCG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|