C21H22ClN3O5 — CID 10320561
6-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamoylamino]hexanoic acid (PubChem CID 10320561) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is 6-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamoylamino]hexanoic acid.
| Compound Name | 6-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 10320561 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 6-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamoylamino]hexanoic acid |
| SMILES | COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1NC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C21H22ClN3O5/c1-29-17-8-6-13(20-24-16-12-14(22)7-9-18(16)30-20)11-15(17)25-21(28)23-10-4-2-3-5-19(26)27/h6-9,11-12H,2-5,10H2,1H3,(H,26,27)(H2,23,25,28) |
| InChIKey | NXMQCVFOORVNDO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|