About 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid
2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid (PubChem CID 103206022) has the molecular formula C6H8F3NO5
and a molecular weight of 231.13 g/mol. Its IUPAC name is 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid |
| PubChem CID | 103206022 |
| Molecular Formula | C6H8F3NO5 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C6H8F3NO5/c7-6(8,9)3-14-1-4(11)10-15-2-5(12)13/h1-3H2,(H,10,11)(H,12,13) |
| InChIKey | OYERMEUQMWYSGA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid?
The IUPAC name of 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid (CID 103206022) is 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid.
What is the SMILES notation for 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid?
The canonical SMILES for 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid is O=C(O)CONC(=O)COCC(F)(F)F.
What is the InChIKey of 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid?
The InChIKey is OYERMEUQMWYSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO5/c7-6(8,9)3-14-1-4(11)10-15-2-5(12)13/h1-3H2,(H,10,11)(H,12,13).
What are the key properties of 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid?
2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid has a molecular weight of 231.13 g/mol, XLogP of -0.30, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,2,2-trifluoroethoxy)acetyl]amino]oxyacetic acid is sourced from PubChem (CID 103206022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).