C11H17F2NO4 — CID 103206059
2-[3-(2,2-difluoroethoxy)propanoylamino]cyclopentane-1-carboxylic acid (PubChem CID 103206059) has the molecular formula C11H17F2NO4 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethoxy)propanoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[3-(2,2-difluoroethoxy)propanoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103206059 |
| Molecular Formula | C11H17F2NO4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[3-(2,2-difluoroethoxy)propanoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CCOCC(F)F)NC1CCCC1C(=O)O |
| InChI | InChI=1S/C11H17F2NO4/c12-9(13)6-18-5-4-10(15)14-8-3-1-2-7(8)11(16)17/h7-9H,1-6H2,(H,14,15)(H,16,17) |
| InChIKey | JTCWCOVDBPISAN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|