About 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid
4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid (PubChem CID 103206181) has the molecular formula C11H17F2NO5
and a molecular weight of 281.25 g/mol. Its IUPAC name is 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid |
| PubChem CID | 103206181 |
| Molecular Formula | C11H17F2NO5 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid |
| SMILES | O=C(CCOCC(F)F)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C11H17F2NO5/c12-8(13)7-19-4-1-9(15)14-11(10(16)17)2-5-18-6-3-11/h8H,1-7H2,(H,14,15)(H,16,17) |
| InChIKey | RAINSNXFEPIKAT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid?
The IUPAC name of 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid (CID 103206181) is 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid.
What is the SMILES notation for 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid?
The canonical SMILES for 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid is O=C(CCOCC(F)F)NC1(C(=O)O)CCOCC1.
What is the InChIKey of 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid?
The InChIKey is RAINSNXFEPIKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO5/c12-8(13)7-19-4-1-9(15)14-11(10(16)17)2-5-18-6-3-11/h8H,1-7H2,(H,14,15)(H,16,17).
What are the key properties of 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid?
4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid has a molecular weight of 281.25 g/mol, XLogP of 0.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,2-difluoroethoxy)propanoylamino]oxane-4-carboxylic acid is sourced from PubChem (CID 103206181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).