C11H17F3N2O2 — CID 103206356
1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206356) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206356 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)N1C[C@@H]2CCN[C@@H]2C1 |
| InChI | InChI=1S/C11H17F3N2O2/c12-11(13,14)7-18-4-2-10(17)16-5-8-1-3-15-9(8)6-16/h8-9,15H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | SXVJZTILZCNIKJ-DTWKUNHWSA-N |
| XLogP | 0.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|