C10H17F3N2O2 — CID 103206366
N-methyl-N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103206366) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is N-methyl-N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-methyl-N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103206366 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-methyl-N-piperidin-3-yl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CN(C(=O)COCC(F)(F)F)C1CCCNC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-15(8-3-2-4-14-5-8)9(16)6-17-7-10(11,12)13/h8,14H,2-7H2,1H3 |
| InChIKey | HHOLXIOOKINQJR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |